C20H26N8S — CID 134201370
8,13-di(piperazin-1-yl)-11-thia-9,14,15,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene (PubChem CID 134201370) has the molecular formula C20H26N8S and a molecular weight of 410.55 g/mol. Its IUPAC name is 8,13-di(piperazin-1-yl)-11-thia-9,14,15,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene.
| Compound Name | 8,13-di(piperazin-1-yl)-11-thia-9,14,15,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene |
|---|---|
| PubChem CID | 134201370 |
| Molecular Formula | C20H26N8S |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 8,13-di(piperazin-1-yl)-11-thia-9,14,15,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene |
| SMILES | C1CCc2c(c(N3CCNCC3)nc3sc4c(N5CCNCC5)nnnc4c23)C1 |
| InChI | InChI=1S/C20H26N8S/c1-2-4-14-13(3-1)15-16-17(19(25-26-24-16)28-11-7-22-8-12-28)29-20(15)23-18(14)27-9-5-21-6-10-27/h21-22H,1-12H2 |
| InChIKey | GBHCLBDIXIUWJN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |