C23H29N5S — CID 3762335
8,13-di(piperidin-1-yl)-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene (PubChem CID 3762335) has the molecular formula C23H29N5S and a molecular weight of 407.59 g/mol. Its IUPAC name is 8,13-di(piperidin-1-yl)-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene.
| Compound Name | 8,13-di(piperidin-1-yl)-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene |
|---|---|
| PubChem CID | 3762335 |
| Molecular Formula | C23H29N5S |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 8,13-di(piperidin-1-yl)-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaene |
| SMILES | c1nc(N2CCCCC2)c2sc3nc(N4CCCCC4)c4c(c3c2n1)CCCC4 |
| InChI | InChI=1S/C23H29N5S/c1-5-11-27(12-6-1)21-17-10-4-3-9-16(17)18-19-20(29-23(18)26-21)22(25-15-24-19)28-13-7-2-8-14-28/h15H,1-14H2 |
| InChIKey | VGINUKUSRJAMLE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |