C18H22N6S — CID 1391116
(8-piperidin-1-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)hydrazine (PubChem CID 1391116) has the molecular formula C18H22N6S and a molecular weight of 354.48 g/mol. Its IUPAC name is (8-piperidin-1-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)hydrazine.
| Compound Name | (8-piperidin-1-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)hydrazine |
|---|---|
| PubChem CID | 1391116 |
| Molecular Formula | C18H22N6S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (8-piperidin-1-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)hydrazine |
| SMILES | NNc1ncnc2c1sc1nc(N3CCCCC3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C18H22N6S/c19-23-16-15-14(20-10-21-16)13-11-6-2-3-7-12(11)17(22-18(13)25-15)24-8-4-1-5-9-24/h10H,1-9,19H2,(H,20,21,23) |
| InChIKey | PMIZPXKLIVEMEK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|