C24H25N5OS — CID 28976566
7-morpholin-4-yl-N-[(1R)-1-phenylethyl]-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine (PubChem CID 28976566) has the molecular formula C24H25N5OS and a molecular weight of 431.57 g/mol. Its IUPAC name is 7-morpholin-4-yl-N-[(1R)-1-phenylethyl]-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine.
| Compound Name | 7-morpholin-4-yl-N-[(1R)-1-phenylethyl]-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine |
|---|---|
| PubChem CID | 28976566 |
| Molecular Formula | C24H25N5OS |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 7-morpholin-4-yl-N-[(1R)-1-phenylethyl]-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine |
| SMILES | C[C@@H](Nc1ncnc2c1sc1nc(N3CCOCC3)c3c(c12)CCC3)c1ccccc1 |
| InChI | InChI=1S/C24H25N5OS/c1-15(16-6-3-2-4-7-16)27-22-21-20(25-14-26-22)19-17-8-5-9-18(17)23(28-24(19)31-21)29-10-12-30-13-11-29/h2-4,6-7,14-15H,5,8-13H2,1H3,(H,25,26,27)/t15-/m1/s1 |
| InChIKey | WHPNHSHDKINEHH-OAHLLOKOSA-N |
| XLogP | 4.74 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |