C21H24N4O3S2 — CID 3362642
ethyl 2-[(8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)sulfanyl]acetate (PubChem CID 3362642) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is ethyl 2-[(8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)sulfanyl]acetate.
| Compound Name | ethyl 2-[(8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 3362642 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | ethyl 2-[(8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1ncnc2c1sc1nc(N3CCOCC3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C21H24N4O3S2/c1-2-28-15(26)11-29-21-18-17(22-12-23-21)16-13-5-3-4-6-14(13)19(24-20(16)30-18)25-7-9-27-10-8-25/h12H,2-11H2,1H3 |
| InChIKey | QPSKDLAZEXWVLG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |