C26H34N6O2S — CID 11648915
1-[3-[(4,4-dimethyl-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)amino]propyl]pyrrolidin-2-one (PubChem CID 11648915) has the molecular formula C26H34N6O2S and a molecular weight of 494.67 g/mol. Its IUPAC name is 1-[3-[(4,4-dimethyl-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(4,4-dimethyl-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11648915 |
| Molecular Formula | C26H34N6O2S |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 1-[3-[(4,4-dimethyl-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)amino]propyl]pyrrolidin-2-one |
| SMILES | CC1(C)CCc2c(N3CCOCC3)nc3sc4c(NCCCN5CCCC5=O)ncnc4c3c2C1 |
| InChI | InChI=1S/C26H34N6O2S/c1-26(2)7-6-17-18(15-26)20-21-22(35-25(20)30-24(17)32-11-13-34-14-12-32)23(29-16-28-21)27-8-4-10-31-9-3-5-19(31)33/h16H,3-15H2,1-2H3,(H,27,28,29) |
| InChIKey | YFBAOXITVIDIPH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|