C20H25N5O3S — CID 4285334
N-(2,2-dimethoxyethyl)-7-morpholin-4-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine (PubChem CID 4285334) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-7-morpholin-4-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-7-morpholin-4-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine |
|---|---|
| PubChem CID | 4285334 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-7-morpholin-4-yl-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-12-amine |
| SMILES | COC(CNc1ncnc2c1sc1nc(N3CCOCC3)c3c(c12)CCC3)OC |
| InChI | InChI=1S/C20H25N5O3S/c1-26-14(27-2)10-21-18-17-16(22-11-23-18)15-12-4-3-5-13(12)19(24-20(15)29-17)25-6-8-28-9-7-25/h11,14H,3-10H2,1-2H3,(H,21,22,23) |
| InChIKey | XKVPRASIGGIPLT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|