C22H26N4O3S2 — CID 1419874
methyl (2S)-2-[(8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)sulfanyl]butanoate (PubChem CID 1419874) has the molecular formula C22H26N4O3S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is methyl (2S)-2-[(8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)sulfanyl]butanoate.
| Compound Name | methyl (2S)-2-[(8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 1419874 |
| Molecular Formula | C22H26N4O3S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | methyl (2S)-2-[(8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)sulfanyl]butanoate |
| SMILES | CC[C@H](Sc1ncnc2c1sc1nc(N3CCOCC3)c3c(c12)CCCC3)C(=O)OC |
| InChI | InChI=1S/C22H26N4O3S2/c1-3-15(22(27)28-2)30-21-18-17(23-12-24-21)16-13-6-4-5-7-14(13)19(25-20(16)31-18)26-8-10-29-11-9-26/h12,15H,3-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | DYYQZNFMUYHXRF-HNNXBMFYSA-N |
| XLogP | 4.00 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |