C22H29N5OS — CID 3447903
N-(3-methylbutyl)-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine (PubChem CID 3447903) has the molecular formula C22H29N5OS and a molecular weight of 411.58 g/mol. Its IUPAC name is N-(3-methylbutyl)-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine.
| Compound Name | N-(3-methylbutyl)-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine |
|---|---|
| PubChem CID | 3447903 |
| Molecular Formula | C22H29N5OS |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-(3-methylbutyl)-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine |
| SMILES | CC(C)CCNc1ncnc2c1sc1nc(N3CCOCC3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C22H29N5OS/c1-14(2)7-8-23-20-19-18(24-13-25-20)17-15-5-3-4-6-16(15)21(26-22(17)29-19)27-9-11-28-12-10-27/h13-14H,3-12H2,1-2H3,(H,23,24,25) |
| InChIKey | AEWZZOPAUUVZDB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |