C23H23N5OS — CID 11575297
N-benzyl-8-pyrrolidin-1-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-amine (PubChem CID 11575297) has the molecular formula C23H23N5OS and a molecular weight of 417.54 g/mol. Its IUPAC name is N-benzyl-8-pyrrolidin-1-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-amine.
| Compound Name | N-benzyl-8-pyrrolidin-1-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-amine |
|---|---|
| PubChem CID | 11575297 |
| Molecular Formula | C23H23N5OS |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-benzyl-8-pyrrolidin-1-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-amine |
| SMILES | c1ccc(CNc2ncnc3c2sc2nc(N4CCCC4)c4c(c23)CCOC4)cc1 |
| InChI | InChI=1S/C23H23N5OS/c1-2-6-15(7-3-1)12-24-21-20-19(25-14-26-21)18-16-8-11-29-13-17(16)22(27-23(18)30-20)28-9-4-5-10-28/h1-3,6-7,14H,4-5,8-13H2,(H,24,25,26) |
| InChIKey | SVGFARSWYHPMCD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |