C22H27N5O2S — CID 166597405
4-(15-methyl-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)morpholine (PubChem CID 166597405) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 4-(15-methyl-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)morpholine.
| Compound Name | 4-(15-methyl-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)morpholine |
|---|---|
| PubChem CID | 166597405 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-(15-methyl-8-morpholin-4-yl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-yl)morpholine |
| SMILES | Cc1nc(N2CCOCC2)c2sc3nc(N4CCOCC4)c4c(c3c2n1)CCCC4 |
| InChI | InChI=1S/C22H27N5O2S/c1-14-23-18-17-15-4-2-3-5-16(15)20(26-6-10-28-11-7-26)25-22(17)30-19(18)21(24-14)27-8-12-29-13-9-27/h2-13H2,1H3 |
| InChIKey | UBGWPABEPFBPGE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |