C20H26N6OS+2 — CID 7177515
4-(12-piperazin-4-ium-1-yl-10-thia-8,15-diaza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11,13,15-hexaen-7-yl)morpholine (PubChem CID 7177515) has the molecular formula C20H26N6OS+2 and a molecular weight of 398.54 g/mol. Its IUPAC name is 4-(12-piperazin-4-ium-1-yl-10-thia-8,15-diaza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11,13,15-hexaen-7-yl)morpholine.
| Compound Name | 4-(12-piperazin-4-ium-1-yl-10-thia-8,15-diaza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11,13,15-hexaen-7-yl)morpholine |
|---|---|
| PubChem CID | 7177515 |
| Molecular Formula | C20H26N6OS+2 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-(12-piperazin-4-ium-1-yl-10-thia-8,15-diaza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11,13,15-hexaen-7-yl)morpholine |
| SMILES | c1nc2c(sc3nc(N4CCOCC4)c4c(c32)CCC4)c(N2CC[NH2+]CC2)[nH+]1 |
| InChI | InChI=1S/C20H24N6OS/c1-2-13-14(3-1)18(26-8-10-27-11-9-26)24-20-15(13)16-17(28-20)19(23-12-22-16)25-6-4-21-5-7-25/h12,21H,1-11H2/p+2 |
| InChIKey | ACJWGEZCKBBQJF-UHFFFAOYSA-P |
| XLogP | 0.37 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |