C18H19N6OS+ — CID 7331102
4-(11-thia-3,7,8,13-tetraza-5-azoniapentacyclo[10.8.0.02,10.05,9.015,20]icosa-1(12),2(10),3,5(9),6,13,15(20)-heptaen-14-yl)morpholine (PubChem CID 7331102) has the molecular formula C18H19N6OS+ and a molecular weight of 367.46 g/mol. Its IUPAC name is 4-(11-thia-3,7,8,13-tetraza-5-azoniapentacyclo[10.8.0.02,10.05,9.015,20]icosa-1(12),2(10),3,5(9),6,13,15(20)-heptaen-14-yl)morpholine.
| Compound Name | 4-(11-thia-3,7,8,13-tetraza-5-azoniapentacyclo[10.8.0.02,10.05,9.015,20]icosa-1(12),2(10),3,5(9),6,13,15(20)-heptaen-14-yl)morpholine |
|---|---|
| PubChem CID | 7331102 |
| Molecular Formula | C18H19N6OS+ |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 4-(11-thia-3,7,8,13-tetraza-5-azoniapentacyclo[10.8.0.02,10.05,9.015,20]icosa-1(12),2(10),3,5(9),6,13,15(20)-heptaen-14-yl)morpholine |
| SMILES | c1n[nH]c2c3sc4nc(N5CCOCC5)c5c(c4c3nc[n+]12)CCCC5 |
| InChI | InChI=1S/C18H18N6OS/c1-2-4-12-11(3-1)13-14-15(17-22-20-10-24(17)9-19-14)26-18(13)21-16(12)23-5-7-25-8-6-23/h9-10H,1-8H2/p+1 |
| InChIKey | CTQRHNRGYRAGSX-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|