C28H27N5O2S — CID 11496957
6-ethoxy-13-methyl-11-(4-phenoxyphenyl)-4-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 11496957) has the molecular formula C28H27N5O2S and a molecular weight of 497.62 g/mol. Its IUPAC name is 6-ethoxy-13-methyl-11-(4-phenoxyphenyl)-4-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-ethoxy-13-methyl-11-(4-phenoxyphenyl)-4-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 11496957 |
| Molecular Formula | C28H27N5O2S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 6-ethoxy-13-methyl-11-(4-phenoxyphenyl)-4-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(-c3ccc(Oc4ccccc4)cc3)cc(C)c12 |
| InChI | InChI=1S/C28H27N5O2S/c1-3-34-26-25-24(31-28(32-26)33-15-13-29-14-16-33)23-18(2)17-22(30-27(23)36-25)19-9-11-21(12-10-19)35-20-7-5-4-6-8-20/h4-12,17,29H,3,13-16H2,1-2H3 |
| InChIKey | NOXYAYWVLZRNRF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |