C15H22ClN3O4Si — CID 172734959
8-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-7-chloro-1H-pyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 172734959) has the molecular formula C15H22ClN3O4Si and a molecular weight of 371.90 g/mol. Its IUPAC name is 8-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-7-chloro-1H-pyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 8-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-7-chloro-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172734959 |
| Molecular Formula | C15H22ClN3O4Si |
| Molecular Weight | 371.90 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 8-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-7-chloro-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCCOc1c(Cl)ncc2c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C15H22ClN3O4Si/c1-15(2,3)24(4,5)23-7-6-22-11-10-9(8-17-12(11)16)13(20)19-14(21)18-10/h8H,6-7H2,1-5H3,(H2,18,19,20,21) |
| InChIKey | IHPGFDGJQRMEQG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.90 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|