C14H19Cl2N3O3Si — CID 15471536
6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dichloropyrrolo[3,4-b]pyrazine-5,7-dione (PubChem CID 15471536) has the molecular formula C14H19Cl2N3O3Si and a molecular weight of 376.32 g/mol. Its IUPAC name is 6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dichloropyrrolo[3,4-b]pyrazine-5,7-dione.
| Compound Name | 6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dichloropyrrolo[3,4-b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 15471536 |
| Molecular Formula | C14H19Cl2N3O3Si |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3-dichloropyrrolo[3,4-b]pyrazine-5,7-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1C(=O)c2nc(Cl)c(Cl)nc2C1=O |
| InChI | InChI=1S/C14H19Cl2N3O3Si/c1-14(2,3)23(4,5)22-7-6-19-12(20)8-9(13(19)21)18-11(16)10(15)17-8/h6-7H2,1-5H3 |
| InChIKey | RHSZWUCWKZYZPH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|