C11H22ClN3OSi — CID 165385908
1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloropyrazol-4-amine (PubChem CID 165385908) has the molecular formula C11H22ClN3OSi and a molecular weight of 275.86 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloropyrazol-4-amine.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloropyrazol-4-amine |
|---|---|
| PubChem CID | 165385908 |
| Molecular Formula | C11H22ClN3OSi |
| Molecular Weight | 275.86 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloropyrazol-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1ncc(N)c1Cl |
| InChI | InChI=1S/C11H22ClN3OSi/c1-11(2,3)17(4,5)16-7-6-15-10(12)9(13)8-14-15/h8H,6-7,13H2,1-5H3 |
| InChIKey | GGZQNJXHZZGNFY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.86 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|