C14H27IN2O2Si — CID 172573565
[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethyl-4-iodopyrazol-5-yl]methanol (PubChem CID 172573565) has the molecular formula C14H27IN2O2Si and a molecular weight of 410.37 g/mol. Its IUPAC name is [1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethyl-4-iodopyrazol-5-yl]methanol.
| Compound Name | [1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethyl-4-iodopyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 172573565 |
| Molecular Formula | C14H27IN2O2Si |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethyl-4-iodopyrazol-5-yl]methanol |
| SMILES | CCc1nn(CCO[Si](C)(C)C(C)(C)C)c(CO)c1I |
| InChI | InChI=1S/C14H27IN2O2Si/c1-7-11-13(15)12(10-18)17(16-11)8-9-19-20(5,6)14(2,3)4/h18H,7-10H2,1-6H3 |
| InChIKey | HCDRYFFCWBNFIH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|