C14H24IN3O3Si — CID 172573659
2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(hydroxymethyl)-4-iodopyrazol-3-yl]oxyacetonitrile (PubChem CID 172573659) has the molecular formula C14H24IN3O3Si and a molecular weight of 437.35 g/mol. Its IUPAC name is 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(hydroxymethyl)-4-iodopyrazol-3-yl]oxyacetonitrile.
| Compound Name | 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(hydroxymethyl)-4-iodopyrazol-3-yl]oxyacetonitrile |
|---|---|
| PubChem CID | 172573659 |
| Molecular Formula | C14H24IN3O3Si |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-(hydroxymethyl)-4-iodopyrazol-3-yl]oxyacetonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1nc(OCC#N)c(I)c1CO |
| InChI | InChI=1S/C14H24IN3O3Si/c1-14(2,3)22(4,5)21-9-7-18-11(10-19)12(15)13(17-18)20-8-6-16/h19H,7-10H2,1-5H3 |
| InChIKey | ZZIHOPQAUFXXEZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|