C15H26N2O2Si — CID 131746830
2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]imidazol-2-yl]but-3-yn-2-ol (PubChem CID 131746830) has the molecular formula C15H26N2O2Si and a molecular weight of 294.47 g/mol. Its IUPAC name is 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]imidazol-2-yl]but-3-yn-2-ol.
| Compound Name | 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]imidazol-2-yl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 131746830 |
| Molecular Formula | C15H26N2O2Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]imidazol-2-yl]but-3-yn-2-ol |
| SMILES | C#CC(C)(O)c1nccn1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H26N2O2Si/c1-8-15(5,18)13-16-9-10-17(13)11-12-19-20(6,7)14(2,3)4/h1,9-10,18H,11-12H2,2-7H3 |
| InChIKey | ICMWLKIPGDPGGG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|