C22H44IN3O5SSi — CID 175965825
[(2R)-1-[[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-propan-2-yloxypyrazol-3-yl]methyl-propan-2-ylamino]propan-2-yl] methanesulfonate (PubChem CID 175965825) has the molecular formula C22H44IN3O5SSi and a molecular weight of 617.67 g/mol. Its IUPAC name is [(2R)-1-[[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-propan-2-yloxypyrazol-3-yl]methyl-propan-2-ylamino]propan-2-yl] methanesulfonate.
| Compound Name | [(2R)-1-[[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-propan-2-yloxypyrazol-3-yl]methyl-propan-2-ylamino]propan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 175965825 |
| Molecular Formula | C22H44IN3O5SSi |
| Molecular Weight | 617.67 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | [(2R)-1-[[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-iodo-5-propan-2-yloxypyrazol-3-yl]methyl-propan-2-ylamino]propan-2-yl] methanesulfonate |
| SMILES | CC(C)Oc1nn(CCO[Si](C)(C)C(C)(C)C)c(CN(C[C@@H](C)OS(C)(=O)=O)C(C)C)c1I |
| InChI | InChI=1S/C22H44IN3O5SSi/c1-16(2)25(14-18(5)31-32(9,27)28)15-19-20(23)21(30-17(3)4)24-26(19)12-13-29-33(10,11)22(6,7)8/h16-18H,12-15H2,1-11H3/t18-/m1/s1 |
| InChIKey | QLQFWTNHZMYOAI-GOSISDBHSA-N |
| XLogP | 4.87 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|