C15H27BrN2O4Si — CID 174058959
5-(bromomethylidene)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-3-methylimidazolidine-2,4-dione (PubChem CID 174058959) has the molecular formula C15H27BrN2O4Si and a molecular weight of 407.38 g/mol. Its IUPAC name is 5-(bromomethylidene)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-3-methylimidazolidine-2,4-dione.
| Compound Name | 5-(bromomethylidene)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174058959 |
| Molecular Formula | C15H27BrN2O4Si |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 5-(bromomethylidene)-1-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(=CBr)N(CCOCCO[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C15H27BrN2O4Si/c1-15(2,3)23(5,6)22-10-9-21-8-7-18-12(11-16)13(19)17(4)14(18)20/h11H,7-10H2,1-6H3 |
| InChIKey | AHGTWIVHHMMNLE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|