C17H31NO7Si — CID 170898911
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]propanoate (PubChem CID 170898911) has the molecular formula C17H31NO7Si and a molecular weight of 389.52 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 170898911 |
| Molecular Formula | C17H31NO7Si |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H31NO7Si/c1-17(2,3)26(4,5)24-13-12-23-11-10-22-9-8-16(21)25-18-14(19)6-7-15(18)20/h6-13H2,1-5H3 |
| InChIKey | MJVHSZBULJDVTD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|