C22H26F6N6O3Si — CID 174058916
5-[[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]methylidene]-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylimidazolidine-2,4-dione (PubChem CID 174058916) has the molecular formula C22H26F6N6O3Si and a molecular weight of 564.56 g/mol. Its IUPAC name is 5-[[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]methylidene]-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylimidazolidine-2,4-dione.
| Compound Name | 5-[[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]methylidene]-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174058916 |
| Molecular Formula | C22H26F6N6O3Si |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 5-[[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]methylidene]-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(=Cn2cnc(-c3cc(C(F)(F)F)nc(C(F)(F)F)c3)n2)N(CCO[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C22H26F6N6O3Si/c1-20(2,3)38(5,6)37-8-7-34-14(18(35)32(4)19(34)36)11-33-12-29-17(31-33)13-9-15(21(23,24)25)30-16(10-13)22(26,27)28/h9-12H,7-8H2,1-6H3 |
| InChIKey | PIPBQBUNOUVIDW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|