C12H15Cl2N3O3Si — CID 15471535
2,3-dichloro-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-b]pyrazine-5,7-dione (PubChem CID 15471535) has the molecular formula C12H15Cl2N3O3Si and a molecular weight of 348.26 g/mol. Its IUPAC name is 2,3-dichloro-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-b]pyrazine-5,7-dione.
| Compound Name | 2,3-dichloro-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 15471535 |
| Molecular Formula | C12H15Cl2N3O3Si |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 2,3-dichloro-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-b]pyrazine-5,7-dione |
| SMILES | C[Si](C)(C)CCOCN1C(=O)c2nc(Cl)c(Cl)nc2C1=O |
| InChI | InChI=1S/C12H15Cl2N3O3Si/c1-21(2,3)5-4-20-6-17-11(18)7-8(12(17)19)16-10(14)9(13)15-7/h4-6H2,1-3H3 |
| InChIKey | VJZXQFQQLIXRCF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|