C21H22ClF2NO2Si — CID 76568139
6-chloro-3-[(3,5-difluorophenyl)methylidene]-1-(2-trimethylsilylethoxymethyl)indol-2-one (PubChem CID 76568139) has the molecular formula C21H22ClF2NO2Si and a molecular weight of 421.95 g/mol. Its IUPAC name is 6-chloro-3-[(3,5-difluorophenyl)methylidene]-1-(2-trimethylsilylethoxymethyl)indol-2-one.
| Compound Name | 6-chloro-3-[(3,5-difluorophenyl)methylidene]-1-(2-trimethylsilylethoxymethyl)indol-2-one |
|---|---|
| PubChem CID | 76568139 |
| Molecular Formula | C21H22ClF2NO2Si |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 6-chloro-3-[(3,5-difluorophenyl)methylidene]-1-(2-trimethylsilylethoxymethyl)indol-2-one |
| SMILES | C[Si](C)(C)CCOCN1C(=O)C(=Cc2cc(F)cc(F)c2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H22ClF2NO2Si/c1-28(2,3)7-6-27-13-25-20-11-15(22)4-5-18(20)19(21(25)26)10-14-8-16(23)12-17(24)9-14/h4-5,8-12H,6-7,13H2,1-3H3 |
| InChIKey | FSAPLJRPUOSGRF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|