C16H23N3O2Si — CID 145416294
4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,3-dihydrobenzimidazole-5-carbonitrile (PubChem CID 145416294) has the molecular formula C16H23N3O2Si and a molecular weight of 317.47 g/mol. Its IUPAC name is 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,3-dihydrobenzimidazole-5-carbonitrile.
| Compound Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,3-dihydrobenzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 145416294 |
| Molecular Formula | C16H23N3O2Si |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-1,3-dihydrobenzimidazole-5-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1c(C#N)ccc2[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C16H23N3O2Si/c1-16(2,3)22(4,5)21-9-8-12-11(10-17)6-7-13-14(12)19-15(20)18-13/h6-7H,8-9H2,1-5H3,(H2,18,19,20) |
| InChIKey | FYBOABYKAIHYPH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|