C17H27NOSSi — CID 139789073
tert-butyl-dimethyl-[2-(5-methylsulfanyl-1H-indol-2-yl)ethoxy]silane (PubChem CID 139789073) has the molecular formula C17H27NOSSi and a molecular weight of 321.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-(5-methylsulfanyl-1H-indol-2-yl)ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-(5-methylsulfanyl-1H-indol-2-yl)ethoxy]silane |
|---|---|
| PubChem CID | 139789073 |
| Molecular Formula | C17H27NOSSi |
| Molecular Weight | 321.56 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | tert-butyl-dimethyl-[2-(5-methylsulfanyl-1H-indol-2-yl)ethoxy]silane |
| SMILES | CSc1ccc2[nH]c(CCO[Si](C)(C)C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C17H27NOSSi/c1-17(2,3)21(5,6)19-10-9-14-11-13-12-15(20-4)7-8-16(13)18-14/h7-8,11-12,18H,9-10H2,1-6H3 |
| InChIKey | ZVUFCDYRCQVZAO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|