C56H96O2P2Si2 — CID 102215591
[2,3-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 102215591) has the molecular formula C56H96O2P2Si2 and a molecular weight of 919.50 g/mol. Its IUPAC name is [2,3-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | [2,3-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 102215591 |
| Molecular Formula | C56H96O2P2Si2 |
| Molecular Weight | 919.50 g/mol |
| Exact Mass | 918.64 |
| IUPAC Name | [2,3-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=c2\c(CCO[Si](C)(C)C(C)(C)C)c(CCO[Si](C)(C)C(C)(C)C)\c2=P/c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C56H96O2P2Si2/c1-49(2,3)37-33-41(51(7,8)9)47(42(34-37)52(10,11)12)59-45-39(29-31-57-61(25,26)55(19,20)21)40(30-32-58-62(27,28)56(22,23)24)46(45)60-48-43(53(13,14)15)35-38(50(4,5)6)36-44(48)54(16,17)18/h33-36H,29-32H2,1-28H3 |
| InChIKey | JQBTYCUMNQIEEG-UHFFFAOYSA-N |
| XLogP | 17.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.50 |
| LogP ≤ 5 | 17.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|