C13H25NO2Si — CID 91459438
3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-1H-pyrrol-2-ol (PubChem CID 91459438) has the molecular formula C13H25NO2Si and a molecular weight of 255.43 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-1H-pyrrol-2-ol.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-1H-pyrrol-2-ol |
|---|---|
| PubChem CID | 91459438 |
| Molecular Formula | C13H25NO2Si |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-1H-pyrrol-2-ol |
| SMILES | Cc1c[nH]c(O)c1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25NO2Si/c1-10-9-14-12(15)11(10)7-8-16-17(5,6)13(2,3)4/h9,14-15H,7-8H2,1-6H3 |
| InChIKey | UDAFDMDZZCSKHY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|