C19H31NO4Si — CID 102271787
methyl 4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-oxo-5-prop-2-enyl-1H-pyridine-3-carboxylate (PubChem CID 102271787) has the molecular formula C19H31NO4Si and a molecular weight of 365.55 g/mol. Its IUPAC name is methyl 4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-oxo-5-prop-2-enyl-1H-pyridine-3-carboxylate.
| Compound Name | methyl 4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-oxo-5-prop-2-enyl-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102271787 |
| Molecular Formula | C19H31NO4Si |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | methyl 4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-oxo-5-prop-2-enyl-1H-pyridine-3-carboxylate |
| SMILES | C=CCc1c(CCCO[Si](C)(C)C(C)(C)C)c(C(=O)OC)c[nH]c1=O |
| InChI | InChI=1S/C19H31NO4Si/c1-8-10-15-14(16(18(22)23-5)13-20-17(15)21)11-9-12-24-25(6,7)19(2,3)4/h8,13H,1,9-12H2,2-7H3,(H,20,21) |
| InChIKey | WPYBRXJSVQKERS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|