C24H36O4Si — CID 101261617
3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5,7-dimethoxy-6-methyl-1-prop-2-enylnaphthalen-2-ol (PubChem CID 101261617) has the molecular formula C24H36O4Si and a molecular weight of 416.63 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5,7-dimethoxy-6-methyl-1-prop-2-enylnaphthalen-2-ol.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5,7-dimethoxy-6-methyl-1-prop-2-enylnaphthalen-2-ol |
|---|---|
| PubChem CID | 101261617 |
| Molecular Formula | C24H36O4Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5,7-dimethoxy-6-methyl-1-prop-2-enylnaphthalen-2-ol |
| SMILES | C=CCc1c(O)c(CCO[Si](C)(C)C(C)(C)C)cc2c(OC)c(C)c(OC)cc12 |
| InChI | InChI=1S/C24H36O4Si/c1-10-11-18-19-15-21(26-6)16(2)23(27-7)20(19)14-17(22(18)25)12-13-28-29(8,9)24(3,4)5/h10,14-15,25H,1,11-13H2,2-9H3 |
| InChIKey | PDEOGCGEVCSPOU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|