C17H30N2O3Si — CID 177149312
methyl 3-amino-4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-2-methylbenzoate (PubChem CID 177149312) has the molecular formula C17H30N2O3Si and a molecular weight of 338.52 g/mol. Its IUPAC name is methyl 3-amino-4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-2-methylbenzoate.
| Compound Name | methyl 3-amino-4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 177149312 |
| Molecular Formula | C17H30N2O3Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | methyl 3-amino-4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-2-methylbenzoate |
| SMILES | COC(=O)c1ccc(NCCO[Si](C)(C)C(C)(C)C)c(N)c1C |
| InChI | InChI=1S/C17H30N2O3Si/c1-12-13(16(20)21-5)8-9-14(15(12)18)19-10-11-22-23(6,7)17(2,3)4/h8-9,19H,10-11,18H2,1-7H3 |
| InChIKey | QLLYIAJMTPMIOE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|