C17H30ClN3O3Si — CID 87184157
ethyl 5-amino-4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]-6-chloropyridine-3-carboxylate (PubChem CID 87184157) has the molecular formula C17H30ClN3O3Si and a molecular weight of 387.98 g/mol. Its IUPAC name is ethyl 5-amino-4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]-6-chloropyridine-3-carboxylate.
| Compound Name | ethyl 5-amino-4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]-6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 87184157 |
| Molecular Formula | C17H30ClN3O3Si |
| Molecular Weight | 387.98 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | ethyl 5-amino-4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]-6-chloropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)c(N)c1NCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30ClN3O3Si/c1-7-23-16(22)12-11-21-15(18)13(19)14(12)20-9-8-10-24-25(5,6)17(2,3)4/h11H,7-10,19H2,1-6H3,(H,20,21) |
| InChIKey | FIBBVYQKTGPTTF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.98 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|