C16H19ClFNO6 — CID 172607422
3-O-tert-butyl 1-O-methyl 2-(2-chloro-5-ethoxycarbonyl-3-fluoro-4-pyridinyl)propanedioate (PubChem CID 172607422) has the molecular formula C16H19ClFNO6 and a molecular weight of 375.78 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 2-(2-chloro-5-ethoxycarbonyl-3-fluoro-4-pyridinyl)propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-methyl 2-(2-chloro-5-ethoxycarbonyl-3-fluoro-4-pyridinyl)propanedioate |
|---|---|
| PubChem CID | 172607422 |
| Molecular Formula | C16H19ClFNO6 |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 2-(2-chloro-5-ethoxycarbonyl-3-fluoro-4-pyridinyl)propanedioate |
| SMILES | CCOC(=O)c1cnc(Cl)c(F)c1C(C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H19ClFNO6/c1-6-24-13(20)8-7-19-12(17)11(18)9(8)10(14(21)23-5)15(22)25-16(2,3)4/h7,10H,6H2,1-5H3 |
| InChIKey | ZENKXWHKJCXEGO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|