C16H16F3NO4 — CID 10337480
ethyl 4-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,3,5-trifluorobenzoate (PubChem CID 10337480) has the molecular formula C16H16F3NO4 and a molecular weight of 343.30 g/mol. Its IUPAC name is ethyl 4-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,3,5-trifluorobenzoate.
| Compound Name | ethyl 4-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,3,5-trifluorobenzoate |
|---|---|
| PubChem CID | 10337480 |
| Molecular Formula | C16H16F3NO4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | ethyl 4-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,3,5-trifluorobenzoate |
| SMILES | CCOC(=O)c1cc(F)c(C(C#N)C(=O)OC(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C16H16F3NO4/c1-5-23-14(21)8-6-10(17)11(13(19)12(8)18)9(7-20)15(22)24-16(2,3)4/h6,9H,5H2,1-4H3 |
| InChIKey | GTKQSKJGVKZAAA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|