C15H21N3O4 — CID 67960619
tert-butyl 2-cyano-2-(4,6-diethoxypyrimidin-2-yl)acetate (PubChem CID 67960619) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is tert-butyl 2-cyano-2-(4,6-diethoxypyrimidin-2-yl)acetate.
| Compound Name | tert-butyl 2-cyano-2-(4,6-diethoxypyrimidin-2-yl)acetate |
|---|---|
| PubChem CID | 67960619 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | tert-butyl 2-cyano-2-(4,6-diethoxypyrimidin-2-yl)acetate |
| SMILES | CCOc1cc(OCC)nc(C(C#N)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C15H21N3O4/c1-6-20-11-8-12(21-7-2)18-13(17-11)10(9-16)14(19)22-15(3,4)5/h8,10H,6-7H2,1-5H3 |
| InChIKey | CRQQCTFZUIBJBF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 94.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |