C12H12Cl2N2O2 — CID 121014992
tert-butyl 2-cyano-2-(3,5-dichloro-2-pyridinyl)acetate (PubChem CID 121014992) has the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.15 g/mol. Its IUPAC name is tert-butyl 2-cyano-2-(3,5-dichloro-2-pyridinyl)acetate.
| Compound Name | tert-butyl 2-cyano-2-(3,5-dichloro-2-pyridinyl)acetate |
|---|---|
| PubChem CID | 121014992 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | tert-butyl 2-cyano-2-(3,5-dichloro-2-pyridinyl)acetate |
| SMILES | CC(C)(C)OC(=O)C(C#N)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O2/c1-12(2,3)18-11(17)8(5-15)10-9(14)4-7(13)6-16-10/h4,6,8H,1-3H3 |
| InChIKey | OTSAWLBFXSZONH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |