C10H11NO5 — CID 15441123
dimethyl 5-methyl-6-oxo-1H-pyridine-3,4-dicarboxylate (PubChem CID 15441123) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is dimethyl 5-methyl-6-oxo-1H-pyridine-3,4-dicarboxylate.
| Compound Name | dimethyl 5-methyl-6-oxo-1H-pyridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15441123 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | dimethyl 5-methyl-6-oxo-1H-pyridine-3,4-dicarboxylate |
| SMILES | COC(=O)c1c[nH]c(=O)c(C)c1C(=O)OC |
| InChI | InChI=1S/C10H11NO5/c1-5-7(10(14)16-3)6(9(13)15-2)4-11-8(5)12/h4H,1-3H3,(H,11,12) |
| InChIKey | QUKHIHIAVDDIOO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |