C9H9NO6 — CID 70300022
3,4-bis(methoxycarbonyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 70300022) has the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. Its IUPAC name is 3,4-bis(methoxycarbonyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3,4-bis(methoxycarbonyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 70300022 |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 3,4-bis(methoxycarbonyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | COC(=O)c1c[nH]c(C(=O)O)c1C(=O)OC |
| InChI | InChI=1S/C9H9NO6/c1-15-8(13)4-3-10-6(7(11)12)5(4)9(14)16-2/h3,10H,1-2H3,(H,11,12) |
| InChIKey | BYKXFOMFGKBOBH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |