C26H42N2O3Si — CID 175890610
tert-butyl 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1H-indol-5-yl]piperidine-1-carboxylate (PubChem CID 175890610) has the molecular formula C26H42N2O3Si and a molecular weight of 458.72 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1H-indol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1H-indol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175890610 |
| Molecular Formula | C26H42N2O3Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | tert-butyl 3-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1H-indol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2ccc3[nH]c(CCO[Si](C)(C)C(C)(C)C)cc3c2)C1 |
| InChI | InChI=1S/C26H42N2O3Si/c1-25(2,3)31-24(29)28-14-9-10-20(18-28)19-11-12-23-21(16-19)17-22(27-23)13-15-30-32(7,8)26(4,5)6/h11-12,16-17,20,27H,9-10,13-15,18H2,1-8H3 |
| InChIKey | VLRZKEQUHLKXHJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|