C27H46ClNO4Si — CID 72529606
tert-butyl 3-[5-[tert-butyl(dimethyl)silyl]oxy-1-(3-chlorophenyl)-1-hydroxypentyl]piperidine-1-carboxylate (PubChem CID 72529606) has the molecular formula C27H46ClNO4Si and a molecular weight of 512.21 g/mol. Its IUPAC name is tert-butyl 3-[5-[tert-butyl(dimethyl)silyl]oxy-1-(3-chlorophenyl)-1-hydroxypentyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-[tert-butyl(dimethyl)silyl]oxy-1-(3-chlorophenyl)-1-hydroxypentyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 72529606 |
| Molecular Formula | C27H46ClNO4Si |
| Molecular Weight | 512.21 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | tert-butyl 3-[5-[tert-butyl(dimethyl)silyl]oxy-1-(3-chlorophenyl)-1-hydroxypentyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(O)(CCCCO[Si](C)(C)C(C)(C)C)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C27H46ClNO4Si/c1-25(2,3)33-24(30)29-17-12-14-22(20-29)27(31,21-13-11-15-23(28)19-21)16-9-10-18-32-34(7,8)26(4,5)6/h11,13,15,19,22,31H,9-10,12,14,16-18,20H2,1-8H3 |
| InChIKey | MDDPNKDOWAQLSL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.21 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|