C20H30ClNO3 — CID 68713595
tert-butyl 3-[(1R)-1-(3-chlorophenyl)-1-hydroxybutyl]piperidine-1-carboxylate (PubChem CID 68713595) has the molecular formula C20H30ClNO3 and a molecular weight of 367.92 g/mol. Its IUPAC name is tert-butyl 3-[(1R)-1-(3-chlorophenyl)-1-hydroxybutyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1R)-1-(3-chlorophenyl)-1-hydroxybutyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68713595 |
| Molecular Formula | C20H30ClNO3 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | tert-butyl 3-[(1R)-1-(3-chlorophenyl)-1-hydroxybutyl]piperidine-1-carboxylate |
| SMILES | CCC[C@](O)(c1cccc(Cl)c1)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H30ClNO3/c1-5-11-20(24,15-8-6-10-17(21)13-15)16-9-7-12-22(14-16)18(23)25-19(2,3)4/h6,8,10,13,16,24H,5,7,9,11-12,14H2,1-4H3/t16?,20-/m0/s1 |
| InChIKey | MCRFAFRRSKQOHB-FZCLLLDFSA-N |
| XLogP | 4.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |