C20H31ClN2O3 — CID 72529637
tert-butyl 3-[1-(2-aminoethoxy)-1-(3-chlorophenyl)ethyl]piperidine-1-carboxylate (PubChem CID 72529637) has the molecular formula C20H31ClN2O3 and a molecular weight of 382.93 g/mol. Its IUPAC name is tert-butyl 3-[1-(2-aminoethoxy)-1-(3-chlorophenyl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(2-aminoethoxy)-1-(3-chlorophenyl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 72529637 |
| Molecular Formula | C20H31ClN2O3 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | tert-butyl 3-[1-(2-aminoethoxy)-1-(3-chlorophenyl)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(C)(OCCN)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H31ClN2O3/c1-19(2,3)26-18(24)23-11-6-8-16(14-23)20(4,25-12-10-22)15-7-5-9-17(21)13-15/h5,7,9,13,16H,6,8,10-12,14,22H2,1-4H3 |
| InChIKey | KJZXMMXDWZNKNF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |