C18H24ClNO5 — CID 69266957
3-[(1R)-1-(3-chlorophenyl)-1-(2-ethoxy-2-oxoethoxy)ethyl]piperidine-1-carboxylic acid (PubChem CID 69266957) has the molecular formula C18H24ClNO5 and a molecular weight of 369.85 g/mol. Its IUPAC name is 3-[(1R)-1-(3-chlorophenyl)-1-(2-ethoxy-2-oxoethoxy)ethyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(1R)-1-(3-chlorophenyl)-1-(2-ethoxy-2-oxoethoxy)ethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69266957 |
| Molecular Formula | C18H24ClNO5 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-[(1R)-1-(3-chlorophenyl)-1-(2-ethoxy-2-oxoethoxy)ethyl]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)CO[C@@](C)(c1cccc(Cl)c1)C1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C18H24ClNO5/c1-3-24-16(21)12-25-18(2,13-6-4-8-15(19)10-13)14-7-5-9-20(11-14)17(22)23/h4,6,8,10,14H,3,5,7,9,11-12H2,1-2H3,(H,22,23)/t14?,18-/m0/s1 |
| InChIKey | BRIVEODJRDKNSB-IBYPIGCZSA-N |
| XLogP | 3.52 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |