C28H43ClN4O5 — CID 68716800
[(2R)-2-[[(3R)-3-[(1R)-1-(3-chlorophenyl)-1-[2-(methylamino)-2-oxoethoxy]ethyl]piperidine-1-carbonyl]amino]-3-cyclohexylpropyl]-methylcarbamic acid (PubChem CID 68716800) has the molecular formula C28H43ClN4O5 and a molecular weight of 551.13 g/mol. Its IUPAC name is [(2R)-2-[[(3R)-3-[(1R)-1-(3-chlorophenyl)-1-[2-(methylamino)-2-oxoethoxy]ethyl]piperidine-1-carbonyl]amino]-3-cyclohexylpropyl]-methylcarbamic acid.
| Compound Name | [(2R)-2-[[(3R)-3-[(1R)-1-(3-chlorophenyl)-1-[2-(methylamino)-2-oxoethoxy]ethyl]piperidine-1-carbonyl]amino]-3-cyclohexylpropyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 68716800 |
| Molecular Formula | C28H43ClN4O5 |
| Molecular Weight | 551.13 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | [(2R)-2-[[(3R)-3-[(1R)-1-(3-chlorophenyl)-1-[2-(methylamino)-2-oxoethoxy]ethyl]piperidine-1-carbonyl]amino]-3-cyclohexylpropyl]-methylcarbamic acid |
| SMILES | CNC(=O)CO[C@@](C)(c1cccc(Cl)c1)[C@@H]1CCCN(C(=O)N[C@H](CC2CCCCC2)CN(C)C(=O)O)C1 |
| InChI | InChI=1S/C28H43ClN4O5/c1-28(38-19-25(34)30-2,21-11-7-13-23(29)16-21)22-12-8-14-33(17-22)26(35)31-24(18-32(3)27(36)37)15-20-9-5-4-6-10-20/h7,11,13,16,20,22,24H,4-6,8-10,12,14-15,17-19H2,1-3H3,(H,30,34)(H,31,35)(H,36,37)/t22-,24-,28+/m1/s1 |
| InChIKey | PNCGYCXYIZGFEM-FAHANXHHSA-N |
| XLogP | 4.69 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.13 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |