C29H46ClN3O2 — CID 67190797
(3R)-3-[1-(3-chlorophenyl)-4-cyclopropyl-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 67190797) has the molecular formula C29H46ClN3O2 and a molecular weight of 504.16 g/mol. Its IUPAC name is (3R)-3-[1-(3-chlorophenyl)-4-cyclopropyl-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[1-(3-chlorophenyl)-4-cyclopropyl-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67190797 |
| Molecular Formula | C29H46ClN3O2 |
| Molecular Weight | 504.16 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | (3R)-3-[1-(3-chlorophenyl)-4-cyclopropyl-1-hydroxybutyl]-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H](C(O)(CCCC2CC2)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C29H46ClN3O2/c1-31-20-27(18-23-8-3-2-4-9-23)32-28(34)33-17-7-12-25(21-33)29(35,16-6-10-22-14-15-22)24-11-5-13-26(30)19-24/h5,11,13,19,22-23,25,27,31,35H,2-4,6-10,12,14-18,20-21H2,1H3,(H,32,34)/t25-,27+,29?/m1/s1 |
| InChIKey | XZDDISLCRKSENF-KRYHRGCLSA-N |
| XLogP | 6.09 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.16 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |