C28H47N3O3 — CID 68708164
(3R)-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1R)-4-ethoxy-1-hydroxy-1-phenylbutyl]piperidine-1-carboxamide (PubChem CID 68708164) has the molecular formula C28H47N3O3 and a molecular weight of 473.70 g/mol. Its IUPAC name is (3R)-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1R)-4-ethoxy-1-hydroxy-1-phenylbutyl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1R)-4-ethoxy-1-hydroxy-1-phenylbutyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 68708164 |
| Molecular Formula | C28H47N3O3 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.36 |
| IUPAC Name | (3R)-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1R)-4-ethoxy-1-hydroxy-1-phenylbutyl]piperidine-1-carboxamide |
| SMILES | CCOCCC[C@](O)(c1ccccc1)[C@@H]1CCCN(C(=O)NC(CNC)CC2CCCCC2)C1 |
| InChI | InChI=1S/C28H47N3O3/c1-3-34-19-11-17-28(33,24-14-8-5-9-15-24)25-16-10-18-31(22-25)27(32)30-26(21-29-2)20-23-12-6-4-7-13-23/h5,8-9,14-15,23,25-26,29,33H,3-4,6-7,10-13,16-22H2,1-2H3,(H,30,32)/t25-,26?,28+/m1/s1 |
| InChIKey | QYNZYNVSBPDWLN-FKKPLYEASA-N |
| XLogP | 4.67 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|