C30H49N3O5 — CID 68709423
[(2R)-3-cyclohexyl-2-[[(3R)-3-(5-ethoxy-1-hydroxy-1-phenylpentyl)piperidine-1-carbonyl]amino]propyl]-methylcarbamic acid (PubChem CID 68709423) has the molecular formula C30H49N3O5 and a molecular weight of 531.74 g/mol. Its IUPAC name is [(2R)-3-cyclohexyl-2-[[(3R)-3-(5-ethoxy-1-hydroxy-1-phenylpentyl)piperidine-1-carbonyl]amino]propyl]-methylcarbamic acid.
| Compound Name | [(2R)-3-cyclohexyl-2-[[(3R)-3-(5-ethoxy-1-hydroxy-1-phenylpentyl)piperidine-1-carbonyl]amino]propyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 68709423 |
| Molecular Formula | C30H49N3O5 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.37 |
| IUPAC Name | [(2R)-3-cyclohexyl-2-[[(3R)-3-(5-ethoxy-1-hydroxy-1-phenylpentyl)piperidine-1-carbonyl]amino]propyl]-methylcarbamic acid |
| SMILES | CCOCCCCC(O)(c1ccccc1)[C@@H]1CCCN(C(=O)N[C@H](CC2CCCCC2)CN(C)C(=O)O)C1 |
| InChI | InChI=1S/C30H49N3O5/c1-3-38-20-11-10-18-30(37,25-15-8-5-9-16-25)26-17-12-19-33(22-26)28(34)31-27(23-32(2)29(35)36)21-24-13-6-4-7-14-24/h5,8-9,15-16,24,26-27,37H,3-4,6-7,10-14,17-23H2,1-2H3,(H,31,34)(H,35,36)/t26-,27-,30?/m1/s1 |
| InChIKey | FIJJXDVYGSUUGQ-KXNYULQOSA-N |
| XLogP | 5.45 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|