C30H48ClN3O2 — CID 67191579
(3R)-3-[1-(3-chlorophenyl)-5-cyclopropyl-1-hydroxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 67191579) has the molecular formula C30H48ClN3O2 and a molecular weight of 518.19 g/mol. Its IUPAC name is (3R)-3-[1-(3-chlorophenyl)-5-cyclopropyl-1-hydroxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[1-(3-chlorophenyl)-5-cyclopropyl-1-hydroxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67191579 |
| Molecular Formula | C30H48ClN3O2 |
| Molecular Weight | 518.19 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | (3R)-3-[1-(3-chlorophenyl)-5-cyclopropyl-1-hydroxypentyl]-N-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNCC(CC1CCCCC1)NC(=O)N1CCC[C@@H](C(O)(CCCCC2CC2)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C30H48ClN3O2/c1-32-21-28(19-24-10-3-2-4-11-24)33-29(35)34-18-8-13-26(22-34)30(36,17-6-5-9-23-15-16-23)25-12-7-14-27(31)20-25/h7,12,14,20,23-24,26,28,32,36H,2-6,8-11,13,15-19,21-22H2,1H3,(H,33,35)/t26-,28?,30?/m1/s1 |
| InChIKey | FMEISJZDTVWKQW-OMJZMDCHSA-N |
| XLogP | 6.48 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.19 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|